C21H24N2O2 — CID 162346434
2-(1-benzylpyrazol-3-yl)-5-pentylbenzene-1,3-diol (PubChem CID 162346434) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 2-(1-benzylpyrazol-3-yl)-5-pentylbenzene-1,3-diol.
| Compound Name | 2-(1-benzylpyrazol-3-yl)-5-pentylbenzene-1,3-diol |
|---|---|
| PubChem CID | 162346434 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 2-(1-benzylpyrazol-3-yl)-5-pentylbenzene-1,3-diol |
| SMILES | CCCCCc1cc(O)c(-c2ccn(Cc3ccccc3)n2)c(O)c1 |
| InChI | InChI=1S/C21H24N2O2/c1-2-3-5-10-17-13-19(24)21(20(25)14-17)18-11-12-23(22-18)15-16-8-6-4-7-9-16/h4,6-9,11-14,24-25H,2-3,5,10,15H2,1H3 |
| InChIKey | XJJKFBQVLOHOCU-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|