C24H40N2O5Si — CID 162347089
benzyl (3S,5R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-triethylsilyloxypiperidine-1-carboxylate (PubChem CID 162347089) has the molecular formula C24H40N2O5Si and a molecular weight of 464.68 g/mol. Its IUPAC name is benzyl (3S,5R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-triethylsilyloxypiperidine-1-carboxylate.
| Compound Name | benzyl (3S,5R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-triethylsilyloxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 162347089 |
| Molecular Formula | C24H40N2O5Si |
| Molecular Weight | 464.68 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | benzyl (3S,5R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-triethylsilyloxypiperidine-1-carboxylate |
| SMILES | CC[Si](CC)(CC)O[C@@H]1C[C@H](NC(=O)OC(C)(C)C)CN(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C24H40N2O5Si/c1-7-32(8-2,9-3)31-21-15-20(25-22(27)30-24(4,5)6)16-26(17-21)23(28)29-18-19-13-11-10-12-14-19/h10-14,20-21H,7-9,15-18H2,1-6H3,(H,25,27)/t20-,21+/m0/s1 |
| InChIKey | WKHRBWNIBADTLL-LEWJYISDSA-N |
| XLogP | 5.31 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.68 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|