C21H30N2O5 — CID 162768687
benzyl 3-(tert-butylperoxycarbonylamino)-5-cyclopropylpiperidine-1-carboxylate (PubChem CID 162768687) has the molecular formula C21H30N2O5 and a molecular weight of 390.48 g/mol. Its IUPAC name is benzyl 3-(tert-butylperoxycarbonylamino)-5-cyclopropylpiperidine-1-carboxylate.
| Compound Name | benzyl 3-(tert-butylperoxycarbonylamino)-5-cyclopropylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 162768687 |
| Molecular Formula | C21H30N2O5 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | benzyl 3-(tert-butylperoxycarbonylamino)-5-cyclopropylpiperidine-1-carboxylate |
| SMILES | CC(C)(C)OOC(=O)NC1CC(C2CC2)CN(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C21H30N2O5/c1-21(2,3)28-27-19(24)22-18-11-17(16-9-10-16)12-23(13-18)20(25)26-14-15-7-5-4-6-8-15/h4-8,16-18H,9-14H2,1-3H3,(H,22,24) |
| InChIKey | AZRHSUFZBOAJIZ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|