C13H15F3O — CID 162347252
1-butoxy-2-(3,3,3-trifluoroprop-1-en-2-yl)benzene (PubChem CID 162347252) has the molecular formula C13H15F3O and a molecular weight of 244.26 g/mol. Its IUPAC name is 1-butoxy-2-(3,3,3-trifluoroprop-1-en-2-yl)benzene.
| Compound Name | 1-butoxy-2-(3,3,3-trifluoroprop-1-en-2-yl)benzene |
|---|---|
| PubChem CID | 162347252 |
| Molecular Formula | C13H15F3O |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 1-butoxy-2-(3,3,3-trifluoroprop-1-en-2-yl)benzene |
| SMILES | C=C(c1ccccc1OCCCC)C(F)(F)F |
| InChI | InChI=1S/C13H15F3O/c1-3-4-9-17-12-8-6-5-7-11(12)10(2)13(14,15)16/h5-8H,2-4,9H2,1H3 |
| InChIKey | OUQWNFKVANVUAZ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|