C15H11F3 — CID 162347965
1-phenyl-2-(1,1,3-trifluoroprop-1-en-2-yl)benzene (PubChem CID 162347965) has the molecular formula C15H11F3 and a molecular weight of 248.25 g/mol. Its IUPAC name is 1-phenyl-2-(1,1,3-trifluoroprop-1-en-2-yl)benzene.
| Compound Name | 1-phenyl-2-(1,1,3-trifluoroprop-1-en-2-yl)benzene |
|---|---|
| PubChem CID | 162347965 |
| Molecular Formula | C15H11F3 |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 1-phenyl-2-(1,1,3-trifluoroprop-1-en-2-yl)benzene |
| SMILES | FCC(=C(F)F)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C15H11F3/c16-10-14(15(17)18)13-9-5-4-8-12(13)11-6-2-1-3-7-11/h1-9H,10H2 |
| InChIKey | WDYSWKVZVOKWGS-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |