C29H32FN5O4 — CID 162348959
[4-[[[2-[[(2R)-2-amino-4-phenylbutanoyl]amino]-3-fluoropropanoyl]amino]methyl]benzenecarboximidoyl]-benzylcarbamic acid (PubChem CID 162348959) has the molecular formula C29H32FN5O4 and a molecular weight of 533.60 g/mol. Its IUPAC name is [4-[[[2-[[(2R)-2-amino-4-phenylbutanoyl]amino]-3-fluoropropanoyl]amino]methyl]benzenecarboximidoyl]-benzylcarbamic acid.
| Compound Name | [4-[[[2-[[(2R)-2-amino-4-phenylbutanoyl]amino]-3-fluoropropanoyl]amino]methyl]benzenecarboximidoyl]-benzylcarbamic acid |
|---|---|
| PubChem CID | 162348959 |
| Molecular Formula | C29H32FN5O4 |
| Molecular Weight | 533.60 g/mol |
| Exact Mass | 533.24 |
| IUPAC Name | [4-[[[2-[[(2R)-2-amino-4-phenylbutanoyl]amino]-3-fluoropropanoyl]amino]methyl]benzenecarboximidoyl]-benzylcarbamic acid |
| SMILES | [H]/N=C(/c1ccc(CNC(=O)C(CF)NC(=O)[C@H](N)CCc2ccccc2)cc1)N(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C29H32FN5O4/c30-17-25(34-27(36)24(31)16-13-20-7-3-1-4-8-20)28(37)33-18-21-11-14-23(15-12-21)26(32)35(29(38)39)19-22-9-5-2-6-10-22/h1-12,14-15,24-25,32H,13,16-19,31H2,(H,33,37)(H,34,36)(H,38,39)/b32-26-/t24-,25?/m1/s1 |
| InChIKey | PZJDLCHHAQJUEJ-BLCYSHAOSA-N |
| XLogP | 3.22 |
| TPSA | 148.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.60 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|