C46H90O7 — CID 162350663
1-(6,6-dihexoxy-1-pentoxyhex-2-enoxy)-6,6-dihexoxy-1-pentoxyhex-2-ene (PubChem CID 162350663) has the molecular formula C46H90O7 and a molecular weight of 755.22 g/mol. Its IUPAC name is 1-(6,6-dihexoxy-1-pentoxyhex-2-enoxy)-6,6-dihexoxy-1-pentoxyhex-2-ene.
| Compound Name | 1-(6,6-dihexoxy-1-pentoxyhex-2-enoxy)-6,6-dihexoxy-1-pentoxyhex-2-ene |
|---|---|
| PubChem CID | 162350663 |
| Molecular Formula | C46H90O7 |
| Molecular Weight | 755.22 g/mol |
| Exact Mass | 754.67 |
| IUPAC Name | 1-(6,6-dihexoxy-1-pentoxyhex-2-enoxy)-6,6-dihexoxy-1-pentoxyhex-2-ene |
| SMILES | CCCCCCOC(CCC=CC(OCCCCC)OC(C=CCCC(OCCCCCC)OCCCCCC)OCCCCC)OCCCCCC |
| InChI | InChI=1S/C46H90O7/c1-7-13-19-29-39-47-43(48-40-30-20-14-8-2)33-23-25-35-45(51-37-27-17-11-5)53-46(52-38-28-18-12-6)36-26-24-34-44(49-41-31-21-15-9-3)50-42-32-22-16-10-4/h25-26,35-36,43-46H,7-24,27-34,37-42H2,1-6H3 |
| InChIKey | YIELYCIVGDSTHM-UHFFFAOYSA-N |
| XLogP | 13.78 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.22 |
| LogP ≤ 5 | 13.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|