C44H86O7 — CID 162350456
1-[6-ethoxy-6-(1-ethoxy-6,6-diheptoxyhex-2-enoxy)-1-heptoxyhex-4-enoxy]heptane (PubChem CID 162350456) has the molecular formula C44H86O7 and a molecular weight of 727.17 g/mol. Its IUPAC name is 1-[6-ethoxy-6-(1-ethoxy-6,6-diheptoxyhex-2-enoxy)-1-heptoxyhex-4-enoxy]heptane.
| Compound Name | 1-[6-ethoxy-6-(1-ethoxy-6,6-diheptoxyhex-2-enoxy)-1-heptoxyhex-4-enoxy]heptane |
|---|---|
| PubChem CID | 162350456 |
| Molecular Formula | C44H86O7 |
| Molecular Weight | 727.17 g/mol |
| Exact Mass | 726.64 |
| IUPAC Name | 1-[6-ethoxy-6-(1-ethoxy-6,6-diheptoxyhex-2-enoxy)-1-heptoxyhex-4-enoxy]heptane |
| SMILES | CCCCCCCOC(CCC=CC(OCC)OC(C=CCCC(OCCCCCCC)OCCCCCCC)OCC)OCCCCCCC |
| InChI | InChI=1S/C44H86O7/c1-7-13-17-21-29-37-47-41(48-38-30-22-18-14-8-2)33-25-27-35-43(45-11-5)51-44(46-12-6)36-28-26-34-42(49-39-31-23-19-15-9-3)50-40-32-24-20-16-10-4/h27-28,35-36,41-44H,7-26,29-34,37-40H2,1-6H3 |
| InChIKey | MURNGVTVHXFOPK-UHFFFAOYSA-N |
| XLogP | 13.00 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.17 |
| LogP ≤ 5 | 13.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|