C24H46O7 — CID 162350431
1,6,6-triethoxy-1-(1,6,6-triethoxyhex-2-enoxy)hex-2-ene (PubChem CID 162350431) has the molecular formula C24H46O7 and a molecular weight of 446.63 g/mol. Its IUPAC name is 1,6,6-triethoxy-1-(1,6,6-triethoxyhex-2-enoxy)hex-2-ene.
| Compound Name | 1,6,6-triethoxy-1-(1,6,6-triethoxyhex-2-enoxy)hex-2-ene |
|---|---|
| PubChem CID | 162350431 |
| Molecular Formula | C24H46O7 |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.32 |
| IUPAC Name | 1,6,6-triethoxy-1-(1,6,6-triethoxyhex-2-enoxy)hex-2-ene |
| SMILES | CCOC(C=CCCC(OCC)OCC)OC(C=CCCC(OCC)OCC)OCC |
| InChI | InChI=1S/C24H46O7/c1-7-25-21(26-8-2)17-13-15-19-23(29-11-5)31-24(30-12-6)20-16-14-18-22(27-9-3)28-10-4/h15-16,19-24H,7-14,17-18H2,1-6H3 |
| InChIKey | VQJPPNVTFNMXOT-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|