C26H25NO5 — CID 162350853
2-benzamido-2,3-bis(4-methylphenyl)pentanedioic acid (PubChem CID 162350853) has the molecular formula C26H25NO5 and a molecular weight of 431.49 g/mol. Its IUPAC name is 2-benzamido-2,3-bis(4-methylphenyl)pentanedioic acid.
| Compound Name | 2-benzamido-2,3-bis(4-methylphenyl)pentanedioic acid |
|---|---|
| PubChem CID | 162350853 |
| Molecular Formula | C26H25NO5 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 2-benzamido-2,3-bis(4-methylphenyl)pentanedioic acid |
| SMILES | Cc1ccc(C(CC(=O)O)C(NC(=O)c2ccccc2)(C(=O)O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C26H25NO5/c1-17-8-12-19(13-9-17)22(16-23(28)29)26(25(31)32,21-14-10-18(2)11-15-21)27-24(30)20-6-4-3-5-7-20/h3-15,22H,16H2,1-2H3,(H,27,30)(H,28,29)(H,31,32) |
| InChIKey | OTJJEPUVLACWCI-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |