C24H20ClNO5 — CID 162350839
2-benzamido-2-(4-chlorophenyl)-3-phenylpentanedioic acid (PubChem CID 162350839) has the molecular formula C24H20ClNO5 and a molecular weight of 437.88 g/mol. Its IUPAC name is 2-benzamido-2-(4-chlorophenyl)-3-phenylpentanedioic acid.
| Compound Name | 2-benzamido-2-(4-chlorophenyl)-3-phenylpentanedioic acid |
|---|---|
| PubChem CID | 162350839 |
| Molecular Formula | C24H20ClNO5 |
| Molecular Weight | 437.88 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | 2-benzamido-2-(4-chlorophenyl)-3-phenylpentanedioic acid |
| SMILES | O=C(O)CC(c1ccccc1)C(NC(=O)c1ccccc1)(C(=O)O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H20ClNO5/c25-19-13-11-18(12-14-19)24(23(30)31,26-22(29)17-9-5-2-6-10-17)20(15-21(27)28)16-7-3-1-4-8-16/h1-14,20H,15H2,(H,26,29)(H,27,28)(H,30,31) |
| InChIKey | YHSFVUBTZRNGMI-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.88 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |