About CID 162352708
CID 162352708 (PubChem CID 162352708) has the molecular formula C8H18NO2Si
and a molecular weight of 188.32 g/mol.
Molecular Properties
| Compound Name | CID 162352708 |
| PubChem CID | 162352708 |
| Molecular Formula | C8H18NO2Si |
| Molecular Weight | 188.32 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | — |
| SMILES | C/C=N/CCC(C)[Si](OC)OC |
| InChI | InChI=1S/C8H18NO2Si/c1-5-9-7-6-8(2)12(10-3)11-4/h5,8H,6-7H2,1-4H3/b9-5+ |
| InChIKey | DHTGZKOEIYMPHC-WEVVVXLNSA-N |
| XLogP | 1.64 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.32 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze CID 162352708 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162352708?
The IUPAC name of CID 162352708 (CID 162352708) is not available.
What is the SMILES notation for CID 162352708?
The canonical SMILES for CID 162352708 is C/C=N/CCC(C)[Si](OC)OC.
What is the InChIKey of CID 162352708?
The InChIKey is DHTGZKOEIYMPHC-WEVVVXLNSA-N. The full InChI is InChI=1S/C8H18NO2Si/c1-5-9-7-6-8(2)12(10-3)11-4/h5,8H,6-7H2,1-4H3/b9-5+.
What are the key properties of CID 162352708?
CID 162352708 has a molecular weight of 188.32 g/mol, XLogP of 1.64, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162352708 is sourced from PubChem (CID 162352708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).