About CID 21298936
CID 21298936 (PubChem CID 21298936) has the molecular formula C4H10ClO2Si
and a molecular weight of 153.66 g/mol.
Molecular Properties
| Compound Name | CID 21298936 |
| PubChem CID | 21298936 |
| Molecular Formula | C4H10ClO2Si |
| Molecular Weight | 153.66 g/mol |
| Exact Mass | 153.01 |
| IUPAC Name | — |
| SMILES | CO[Si](OC)C(C)Cl |
| InChI | InChI=1S/C4H10ClO2Si/c1-4(5)8(6-2)7-3/h4H,1-3H3 |
| InChIKey | HYVRHGNNZDBTDV-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.66 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 21298936 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 21298936?
The IUPAC name of CID 21298936 (CID 21298936) is not available.
What is the SMILES notation for CID 21298936?
The canonical SMILES for CID 21298936 is CO[Si](OC)C(C)Cl.
What is the InChIKey of CID 21298936?
The InChIKey is HYVRHGNNZDBTDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10ClO2Si/c1-4(5)8(6-2)7-3/h4H,1-3H3.
What are the key properties of CID 21298936?
CID 21298936 has a molecular weight of 153.66 g/mol, XLogP of 0.93, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 21298936 is sourced from PubChem (CID 21298936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).