C18H40N2O — CID 162353474
N-[1-[1-[3,3-dimethylbutyl(methyl)amino]ethoxy]ethyl]-N,3,3-trimethylbutan-1-amine (PubChem CID 162353474) has the molecular formula C18H40N2O and a molecular weight of 300.53 g/mol. Its IUPAC name is N-[1-[1-[3,3-dimethylbutyl(methyl)amino]ethoxy]ethyl]-N,3,3-trimethylbutan-1-amine.
| Compound Name | N-[1-[1-[3,3-dimethylbutyl(methyl)amino]ethoxy]ethyl]-N,3,3-trimethylbutan-1-amine |
|---|---|
| PubChem CID | 162353474 |
| Molecular Formula | C18H40N2O |
| Molecular Weight | 300.53 g/mol |
| Exact Mass | 300.31 |
| IUPAC Name | N-[1-[1-[3,3-dimethylbutyl(methyl)amino]ethoxy]ethyl]-N,3,3-trimethylbutan-1-amine |
| SMILES | CC(OC(C)N(C)CCC(C)(C)C)N(C)CCC(C)(C)C |
| InChI | InChI=1S/C18H40N2O/c1-15(19(9)13-11-17(3,4)5)21-16(2)20(10)14-12-18(6,7)8/h15-16H,11-14H2,1-10H3 |
| InChIKey | RFHVKFHNRQXTGO-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.53 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|