C22H50N2O6S — CID 162353879
diazanium;tert-butyl sulfate;(Z)-octadec-9-enoate (PubChem CID 162353879) has the molecular formula C22H50N2O6S and a molecular weight of 470.72 g/mol. Its IUPAC name is diazanium;tert-butyl sulfate;(Z)-octadec-9-enoate.
| Compound Name | diazanium;tert-butyl sulfate;(Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 162353879 |
| Molecular Formula | C22H50N2O6S |
| Molecular Weight | 470.72 g/mol |
| Exact Mass | 470.34 |
| IUPAC Name | diazanium;tert-butyl sulfate;(Z)-octadec-9-enoate |
| SMILES | CC(C)(C)OS(=O)(=O)[O-].CCCCCCCC/C=C\CCCCCCCC(=O)[O-].[NH4+].[NH4+] |
| InChI | InChI=1S/C18H34O2.C4H10O4S.2H3N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-4(2,3)8-9(5,6)7;;/h9-10H,2-8,11-17H2,1H3,(H,19,20);1-3H3,(H,5,6,7);2*1H3/b10-9-;;; |
| InChIKey | BRXCOFDXJWKTKN-BZKIHGKGSA-N |
| XLogP | 5.79 |
| TPSA | 179.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.72 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|