C25H21ClN2O3 — CID 162354369
2-[3-[7-chloro-6-[4-(dimethylamino)phenyl]-2-oxo-1H-quinolin-3-yl]phenyl]acetic acid (PubChem CID 162354369) has the molecular formula C25H21ClN2O3 and a molecular weight of 432.91 g/mol. Its IUPAC name is 2-[3-[7-chloro-6-[4-(dimethylamino)phenyl]-2-oxo-1H-quinolin-3-yl]phenyl]acetic acid.
| Compound Name | 2-[3-[7-chloro-6-[4-(dimethylamino)phenyl]-2-oxo-1H-quinolin-3-yl]phenyl]acetic acid |
|---|---|
| PubChem CID | 162354369 |
| Molecular Formula | C25H21ClN2O3 |
| Molecular Weight | 432.91 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | 2-[3-[7-chloro-6-[4-(dimethylamino)phenyl]-2-oxo-1H-quinolin-3-yl]phenyl]acetic acid |
| SMILES | CN(C)c1ccc(-c2cc3cc(-c4cccc(CC(=O)O)c4)c(=O)[nH]c3cc2Cl)cc1 |
| InChI | InChI=1S/C25H21ClN2O3/c1-28(2)19-8-6-16(7-9-19)20-12-18-13-21(25(31)27-23(18)14-22(20)26)17-5-3-4-15(10-17)11-24(29)30/h3-10,12-14H,11H2,1-2H3,(H,27,31)(H,29,30) |
| InChIKey | BWZYFTXBUWKGFB-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.91 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |