C31H24ClNO4 — CID 162354375
ethyl 2-[4-[7-chloro-6-[4-(2-hydroxyphenyl)phenyl]-2-oxo-1H-quinolin-3-yl]phenyl]acetate (PubChem CID 162354375) has the molecular formula C31H24ClNO4 and a molecular weight of 509.99 g/mol. Its IUPAC name is ethyl 2-[4-[7-chloro-6-[4-(2-hydroxyphenyl)phenyl]-2-oxo-1H-quinolin-3-yl]phenyl]acetate.
| Compound Name | ethyl 2-[4-[7-chloro-6-[4-(2-hydroxyphenyl)phenyl]-2-oxo-1H-quinolin-3-yl]phenyl]acetate |
|---|---|
| PubChem CID | 162354375 |
| Molecular Formula | C31H24ClNO4 |
| Molecular Weight | 509.99 g/mol |
| Exact Mass | 509.14 |
| IUPAC Name | ethyl 2-[4-[7-chloro-6-[4-(2-hydroxyphenyl)phenyl]-2-oxo-1H-quinolin-3-yl]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(-c2cc3cc(-c4ccc(-c5ccccc5O)cc4)c(Cl)cc3[nH]c2=O)cc1 |
| InChI | InChI=1S/C31H24ClNO4/c1-2-37-30(35)15-19-7-9-22(10-8-19)26-17-23-16-25(27(32)18-28(23)33-31(26)36)21-13-11-20(12-14-21)24-5-3-4-6-29(24)34/h3-14,16-18,34H,2,15H2,1H3,(H,33,36) |
| InChIKey | SPGVODSRBBOBQT-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.99 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |