C25H31N6O4P — CID 162354487
4-(2-methoxyethylamino)-6-[2-methoxy-4-[1-(oxetan-3-yl)-4-oxo-1,4λ5-azaphosphinan-4-yl]anilino]-1H-pyrrolo[2,3-b]pyridine-3-carbonitrile (PubChem CID 162354487) has the molecular formula C25H31N6O4P and a molecular weight of 510.54 g/mol. Its IUPAC name is 4-(2-methoxyethylamino)-6-[2-methoxy-4-[1-(oxetan-3-yl)-4-oxo-1,4λ5-azaphosphinan-4-yl]anilino]-1H-pyrrolo[2,3-b]pyridine-3-carbonitrile.
| Compound Name | 4-(2-methoxyethylamino)-6-[2-methoxy-4-[1-(oxetan-3-yl)-4-oxo-1,4λ5-azaphosphinan-4-yl]anilino]-1H-pyrrolo[2,3-b]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 162354487 |
| Molecular Formula | C25H31N6O4P |
| Molecular Weight | 510.54 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | 4-(2-methoxyethylamino)-6-[2-methoxy-4-[1-(oxetan-3-yl)-4-oxo-1,4λ5-azaphosphinan-4-yl]anilino]-1H-pyrrolo[2,3-b]pyridine-3-carbonitrile |
| SMILES | COCCNc1cc(Nc2ccc(P3(=O)CCN(C4COC4)CC3)cc2OC)nc2[nH]cc(C#N)c12 |
| InChI | InChI=1S/C25H31N6O4P/c1-33-8-5-27-21-12-23(30-25-24(21)17(13-26)14-28-25)29-20-4-3-19(11-22(20)34-2)36(32)9-6-31(7-10-36)18-15-35-16-18/h3-4,11-12,14,18H,5-10,15-16H2,1-2H3,(H3,27,28,29,30) |
| InChIKey | LKIFDEHTCLPKTP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 124.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.54 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|