C11H14N4O2S2 — CID 162357816
(1E,2Z)-2-amino-2-hydroxyimino-N-(4-methylphenyl)sulfanyloxyethanimidoyl cyanide;methanethiol (PubChem CID 162357816) has the molecular formula C11H14N4O2S2 and a molecular weight of 298.39 g/mol. Its IUPAC name is (1E,2Z)-2-amino-2-hydroxyimino-N-(4-methylphenyl)sulfanyloxyethanimidoyl cyanide;methanethiol.
| Compound Name | (1E,2Z)-2-amino-2-hydroxyimino-N-(4-methylphenyl)sulfanyloxyethanimidoyl cyanide;methanethiol |
|---|---|
| PubChem CID | 162357816 |
| Molecular Formula | C11H14N4O2S2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | (1E,2Z)-2-amino-2-hydroxyimino-N-(4-methylphenyl)sulfanyloxyethanimidoyl cyanide;methanethiol |
| SMILES | CS.Cc1ccc(SO/N=C(C#N)/C(N)=N/O)cc1 |
| InChI | InChI=1S/C10H10N4O2S.CH4S/c1-7-2-4-8(5-3-7)17-16-14-9(6-11)10(12)13-15;1-2/h2-5,15H,1H3,(H2,12,13);2H,1H3/b14-9+; |
| InChIKey | HBVBBUHXLGWFDT-KYIGKLDSSA-N |
| XLogP | 2.19 |
| TPSA | 103.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|