About (1Z,2Z)-N,N'-bis[(4-methoxyphenyl)sulfanyl]ethanediimidoyl dicyanide
(1Z,2Z)-N,N'-bis[(4-methoxyphenyl)sulfanyl]ethanediimidoyl dicyanide (PubChem CID 134998704) has the molecular formula C18H14N4O2S2
and a molecular weight of 382.47 g/mol. Its IUPAC name is (1Z,2Z)-N,N'-bis[(4-methoxyphenyl)sulfanyl]ethanediimidoyl dicyanide.
Molecular Properties
| Compound Name | (1Z,2Z)-N,N'-bis[(4-methoxyphenyl)sulfanyl]ethanediimidoyl dicyanide |
| PubChem CID | 134998704 |
| Molecular Formula | C18H14N4O2S2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | (1Z,2Z)-N,N'-bis[(4-methoxyphenyl)sulfanyl]ethanediimidoyl dicyanide |
| SMILES | COc1ccc(S/N=C(C#N)/C(C#N)=N/Sc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C18H14N4O2S2/c1-23-13-3-7-15(8-4-13)25-21-17(11-19)18(12-20)22-26-16-9-5-14(24-2)6-10-16/h3-10H,1-2H3/b21-17+,22-18+ |
| InChIKey | MXDABOKXEFXJOZ-KSTNYAOJSA-N |
| XLogP | 4.35 |
| TPSA | 90.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1Z,2Z)-N,N'-bis[(4-methoxyphenyl)sulfanyl]ethanediimidoyl dicyanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z,2Z)-N,N'-bis[(4-methoxyphenyl)sulfanyl]ethanediimidoyl dicyanide?
The IUPAC name of (1Z,2Z)-N,N'-bis[(4-methoxyphenyl)sulfanyl]ethanediimidoyl dicyanide (CID 134998704) is (1Z,2Z)-N,N'-bis[(4-methoxyphenyl)sulfanyl]ethanediimidoyl dicyanide.
What is the SMILES notation for (1Z,2Z)-N,N'-bis[(4-methoxyphenyl)sulfanyl]ethanediimidoyl dicyanide?
The canonical SMILES for (1Z,2Z)-N,N'-bis[(4-methoxyphenyl)sulfanyl]ethanediimidoyl dicyanide is COc1ccc(S/N=C(C#N)/C(C#N)=N/Sc2ccc(OC)cc2)cc1.
What is the InChIKey of (1Z,2Z)-N,N'-bis[(4-methoxyphenyl)sulfanyl]ethanediimidoyl dicyanide?
The InChIKey is MXDABOKXEFXJOZ-KSTNYAOJSA-N. The full InChI is InChI=1S/C18H14N4O2S2/c1-23-13-3-7-15(8-4-13)25-21-17(11-19)18(12-20)22-26-16-9-5-14(24-2)6-10-16/h3-10H,1-2H3/b21-17+,22-18+.
What are the key properties of (1Z,2Z)-N,N'-bis[(4-methoxyphenyl)sulfanyl]ethanediimidoyl dicyanide?
(1Z,2Z)-N,N'-bis[(4-methoxyphenyl)sulfanyl]ethanediimidoyl dicyanide has a molecular weight of 382.47 g/mol, XLogP of 4.35, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z,2Z)-N,N'-bis[(4-methoxyphenyl)sulfanyl]ethanediimidoyl dicyanide is sourced from PubChem (CID 134998704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).