C10H19N3O2 — CID 162358343
N-methyl-1,1-dimorpholin-4-ylmethanimine (PubChem CID 162358343) has the molecular formula C10H19N3O2 and a molecular weight of 213.28 g/mol. Its IUPAC name is N-methyl-1,1-dimorpholin-4-ylmethanimine.
| Compound Name | N-methyl-1,1-dimorpholin-4-ylmethanimine |
|---|---|
| PubChem CID | 162358343 |
| Molecular Formula | C10H19N3O2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | N-methyl-1,1-dimorpholin-4-ylmethanimine |
| SMILES | CN=C(N1CCOCC1)N1CCOCC1 |
| InChI | InChI=1S/C10H19N3O2/c1-11-10(12-2-6-14-7-3-12)13-4-8-15-9-5-13/h2-9H2,1H3 |
| InChIKey | WTVDKUBWESLHPC-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 37.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|