C13H26N6O2 — CID 11077383
(3E)-3-[dimethylamino-[(E)-[dimethylamino(morpholin-4-yl)methylidene]amino]methylidene]-1,1-dimethylurea (PubChem CID 11077383) has the molecular formula C13H26N6O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is (3E)-3-[dimethylamino-[(E)-[dimethylamino(morpholin-4-yl)methylidene]amino]methylidene]-1,1-dimethylurea.
| Compound Name | (3E)-3-[dimethylamino-[(E)-[dimethylamino(morpholin-4-yl)methylidene]amino]methylidene]-1,1-dimethylurea |
|---|---|
| PubChem CID | 11077383 |
| Molecular Formula | C13H26N6O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | (3E)-3-[dimethylamino-[(E)-[dimethylamino(morpholin-4-yl)methylidene]amino]methylidene]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)/N=C(/N=C(\N(C)C)N1CCOCC1)N(C)C |
| InChI | InChI=1S/C13H26N6O2/c1-16(2)11(15-13(20)18(5)6)14-12(17(3)4)19-7-9-21-10-8-19/h7-10H2,1-6H3/b14-12+,15-11- |
| InChIKey | LWWRHMDVCLFAPI-BASNAROOSA-N |
| XLogP | -0.16 |
| TPSA | 63.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|