C8H12N4O3 — CID 12026137
4-methoxy-6-morpholin-4-yl-1H-1,3,5-triazin-2-one (PubChem CID 12026137) has the molecular formula C8H12N4O3 and a molecular weight of 212.21 g/mol. Its IUPAC name is 4-methoxy-6-morpholin-4-yl-1H-1,3,5-triazin-2-one.
| Compound Name | 4-methoxy-6-morpholin-4-yl-1H-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 12026137 |
| Molecular Formula | C8H12N4O3 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 4-methoxy-6-morpholin-4-yl-1H-1,3,5-triazin-2-one |
| SMILES | COc1nc(N2CCOCC2)[nH]c(=O)n1 |
| InChI | InChI=1S/C8H12N4O3/c1-14-8-10-6(9-7(13)11-8)12-2-4-15-5-3-12/h2-5H2,1H3,(H,9,10,11,13) |
| InChIKey | XFPBTFUSCSZBFW-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |