C10H21N4O3+ — CID 67382888
4-(1,3-dimethoxy-2,4-dihydro-1,3,5-triazin-6-yl)-4-methylmorpholin-4-ium (PubChem CID 67382888) has the molecular formula C10H21N4O3+ and a molecular weight of 245.30 g/mol. Its IUPAC name is 4-(1,3-dimethoxy-2,4-dihydro-1,3,5-triazin-6-yl)-4-methylmorpholin-4-ium.
| Compound Name | 4-(1,3-dimethoxy-2,4-dihydro-1,3,5-triazin-6-yl)-4-methylmorpholin-4-ium |
|---|---|
| PubChem CID | 67382888 |
| Molecular Formula | C10H21N4O3+ |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | 4-(1,3-dimethoxy-2,4-dihydro-1,3,5-triazin-6-yl)-4-methylmorpholin-4-ium |
| SMILES | CON1CN=C([N+]2(C)CCOCC2)N(OC)C1 |
| InChI | InChI=1S/C10H21N4O3/c1-14(4-6-17-7-5-14)10-11-8-12(15-2)9-13(10)16-3/h4-9H2,1-3H3/q+1 |
| InChIKey | VAZVLYQHYHKQDZ-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 46.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|