C10H19ClN4O3 — CID 68925000
4-(1,2-dimethoxy-2H-1,3,5-triazin-4-yl)-4-methylmorpholin-4-ium chloride (PubChem CID 68925000) has the molecular formula C10H19ClN4O3 and a molecular weight of 278.74 g/mol. Its IUPAC name is 4-(1,2-dimethoxy-2H-1,3,5-triazin-4-yl)-4-methylmorpholin-4-ium chloride.
| Compound Name | 4-(1,2-dimethoxy-2H-1,3,5-triazin-4-yl)-4-methylmorpholin-4-ium chloride |
|---|---|
| PubChem CID | 68925000 |
| Molecular Formula | C10H19ClN4O3 |
| Molecular Weight | 278.74 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 4-(1,2-dimethoxy-2H-1,3,5-triazin-4-yl)-4-methylmorpholin-4-ium chloride |
| SMILES | COC1N=C([N+]2(C)CCOCC2)N=CN1OC.[Cl-] |
| InChI | InChI=1S/C10H19N4O3.ClH/c1-14(4-6-17-7-5-14)9-11-8-13(16-3)10(12-9)15-2;/h8,10H,4-7H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | CTQHNHKWMORZCE-UHFFFAOYSA-M |
| XLogP | -3.34 |
| TPSA | 55.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.74 |
| LogP ≤ 5 | -3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|