About N-(diaminomethylidene)-N'-methylmorpholine-4-carboximidamide;ethane
N-(diaminomethylidene)-N'-methylmorpholine-4-carboximidamide;ethane (PubChem CID 142039327) has the molecular formula C9H21N5O
and a molecular weight of 215.30 g/mol. Its IUPAC name is N-(diaminomethylidene)-N'-methylmorpholine-4-carboximidamide;ethane.
Molecular Properties
| Compound Name | N-(diaminomethylidene)-N'-methylmorpholine-4-carboximidamide;ethane |
| PubChem CID | 142039327 |
| Molecular Formula | C9H21N5O |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | N-(diaminomethylidene)-N'-methylmorpholine-4-carboximidamide;ethane |
| SMILES | C/N=C(/N=C(N)N)N1CCOCC1.CC |
| InChI | InChI=1S/C7H15N5O.C2H6/c1-10-7(11-6(8)9)12-2-4-13-5-3-12;1-2/h2-5H2,1H3,(H4,8,9,10,11);1-2H3 |
| InChIKey | HNIFJERAUAEONG-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 89.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(diaminomethylidene)-N'-methylmorpholine-4-carboximidamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(diaminomethylidene)-N'-methylmorpholine-4-carboximidamide;ethane?
The IUPAC name of N-(diaminomethylidene)-N'-methylmorpholine-4-carboximidamide;ethane (CID 142039327) is N-(diaminomethylidene)-N'-methylmorpholine-4-carboximidamide;ethane.
What is the SMILES notation for N-(diaminomethylidene)-N'-methylmorpholine-4-carboximidamide;ethane?
The canonical SMILES for N-(diaminomethylidene)-N'-methylmorpholine-4-carboximidamide;ethane is C/N=C(/N=C(N)N)N1CCOCC1.CC.
What is the InChIKey of N-(diaminomethylidene)-N'-methylmorpholine-4-carboximidamide;ethane?
The InChIKey is HNIFJERAUAEONG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N5O.C2H6/c1-10-7(11-6(8)9)12-2-4-13-5-3-12;1-2/h2-5H2,1H3,(H4,8,9,10,11);1-2H3.
What are the key properties of N-(diaminomethylidene)-N'-methylmorpholine-4-carboximidamide;ethane?
N-(diaminomethylidene)-N'-methylmorpholine-4-carboximidamide;ethane has a molecular weight of 215.30 g/mol, XLogP of -0.40, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(diaminomethylidene)-N'-methylmorpholine-4-carboximidamide;ethane is sourced from PubChem (CID 142039327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).