C22H26N6O3S — CID 162360168
4-[(10,12-dimethyl-11-oxospiro[1,3,5,10-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-4-yl)amino]benzenesulfonamide (PubChem CID 162360168) has the molecular formula C22H26N6O3S and a molecular weight of 454.56 g/mol. Its IUPAC name is 4-[(10,12-dimethyl-11-oxospiro[1,3,5,10-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-4-yl)amino]benzenesulfonamide.
| Compound Name | 4-[(10,12-dimethyl-11-oxospiro[1,3,5,10-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-4-yl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 162360168 |
| Molecular Formula | C22H26N6O3S |
| Molecular Weight | 454.56 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | 4-[(10,12-dimethyl-11-oxospiro[1,3,5,10-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-4-yl)amino]benzenesulfonamide |
| SMILES | CC1C(=O)N(C)c2cc3cnc(Nc4ccc(S(N)(=O)=O)cc4)nc3n2C12CCCCC2 |
| InChI | InChI=1S/C22H26N6O3S/c1-14-20(29)27(2)18-12-15-13-24-21(25-16-6-8-17(9-7-16)32(23,30)31)26-19(15)28(18)22(14)10-4-3-5-11-22/h6-9,12-14H,3-5,10-11H2,1-2H3,(H2,23,30,31)(H,24,25,26) |
| InChIKey | FLIVKVQMXOAQAK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 123.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.56 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |