C24H23FN4O3S — CID 155553628
N-[2-[(4-fluorophenyl)sulfonylamino]ethyl]-3-[4-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]propanamide (PubChem CID 155553628) has the molecular formula C24H23FN4O3S and a molecular weight of 466.54 g/mol. Its IUPAC name is N-[2-[(4-fluorophenyl)sulfonylamino]ethyl]-3-[4-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]propanamide.
| Compound Name | N-[2-[(4-fluorophenyl)sulfonylamino]ethyl]-3-[4-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 155553628 |
| Molecular Formula | C24H23FN4O3S |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | N-[2-[(4-fluorophenyl)sulfonylamino]ethyl]-3-[4-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]propanamide |
| SMILES | O=C(CCc1ccc(-c2cnc3[nH]ccc3c2)cc1)NCCNS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H23FN4O3S/c25-21-6-8-22(9-7-21)33(31,32)29-14-13-26-23(30)10-3-17-1-4-18(5-2-17)20-15-19-11-12-27-24(19)28-16-20/h1-2,4-9,11-12,15-16,29H,3,10,13-14H2,(H,26,30)(H,27,28) |
| InChIKey | FBBZYQXPSQBBCZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|