C24H26N4O2S — CID 155523205
N-[2-[3-[4-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]propylamino]ethyl]benzenesulfonamide (PubChem CID 155523205) has the molecular formula C24H26N4O2S and a molecular weight of 434.57 g/mol. Its IUPAC name is N-[2-[3-[4-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]propylamino]ethyl]benzenesulfonamide.
| Compound Name | N-[2-[3-[4-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]propylamino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 155523205 |
| Molecular Formula | C24H26N4O2S |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | N-[2-[3-[4-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]propylamino]ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCNCCCc1ccc(-c2cnc3[nH]ccc3c2)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H26N4O2S/c29-31(30,23-6-2-1-3-7-23)28-16-15-25-13-4-5-19-8-10-20(11-9-19)22-17-21-12-14-26-24(21)27-18-22/h1-3,6-12,14,17-18,25,28H,4-5,13,15-16H2,(H,26,27) |
| InChIKey | JOJUJDXKWGOXON-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|