C19H24N4O2S — CID 170502375
N-[3-(dimethylamino)propyl]-3-methyl-4-(1H-pyrrolo[2,3-b]pyridin-5-yl)benzenesulfonamide (PubChem CID 170502375) has the molecular formula C19H24N4O2S and a molecular weight of 372.49 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-3-methyl-4-(1H-pyrrolo[2,3-b]pyridin-5-yl)benzenesulfonamide.
| Compound Name | N-[3-(dimethylamino)propyl]-3-methyl-4-(1H-pyrrolo[2,3-b]pyridin-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 170502375 |
| Molecular Formula | C19H24N4O2S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-3-methyl-4-(1H-pyrrolo[2,3-b]pyridin-5-yl)benzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCCCN(C)C)ccc1-c1cnc2[nH]ccc2c1 |
| InChI | InChI=1S/C19H24N4O2S/c1-14-11-17(26(24,25)22-8-4-10-23(2)3)5-6-18(14)16-12-15-7-9-20-19(15)21-13-16/h5-7,9,11-13,22H,4,8,10H2,1-3H3,(H,20,21) |
| InChIKey | PWHZMSPTNPZBPK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|