C20H26N4O3S — CID 23648916
N-[3-[2-(dimethylamino)ethoxy]propyl]-4-(1H-pyrrolo[2,3-b]pyridin-4-yl)benzenesulfonamide (PubChem CID 23648916) has the molecular formula C20H26N4O3S and a molecular weight of 402.52 g/mol. Its IUPAC name is N-[3-[2-(dimethylamino)ethoxy]propyl]-4-(1H-pyrrolo[2,3-b]pyridin-4-yl)benzenesulfonamide.
| Compound Name | N-[3-[2-(dimethylamino)ethoxy]propyl]-4-(1H-pyrrolo[2,3-b]pyridin-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 23648916 |
| Molecular Formula | C20H26N4O3S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | N-[3-[2-(dimethylamino)ethoxy]propyl]-4-(1H-pyrrolo[2,3-b]pyridin-4-yl)benzenesulfonamide |
| SMILES | CN(C)CCOCCCNS(=O)(=O)c1ccc(-c2ccnc3[nH]ccc23)cc1 |
| InChI | InChI=1S/C20H26N4O3S/c1-24(2)13-15-27-14-3-10-23-28(25,26)17-6-4-16(5-7-17)18-8-11-21-20-19(18)9-12-22-20/h4-9,11-12,23H,3,10,13-15H2,1-2H3,(H,21,22) |
| InChIKey | HQWIZVSNAOOMTE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|