C20H22F3N3O4S — CID 68632750
N-butyl-4-(2-methyl-1H-pyrrolo[2,3-b]pyridin-4-yl)benzenesulfonamide;2,2,2-trifluoroacetic acid (PubChem CID 68632750) has the molecular formula C20H22F3N3O4S and a molecular weight of 457.47 g/mol. Its IUPAC name is N-butyl-4-(2-methyl-1H-pyrrolo[2,3-b]pyridin-4-yl)benzenesulfonamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-butyl-4-(2-methyl-1H-pyrrolo[2,3-b]pyridin-4-yl)benzenesulfonamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 68632750 |
| Molecular Formula | C20H22F3N3O4S |
| Molecular Weight | 457.47 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | N-butyl-4-(2-methyl-1H-pyrrolo[2,3-b]pyridin-4-yl)benzenesulfonamide;2,2,2-trifluoroacetic acid |
| SMILES | CCCCNS(=O)(=O)c1ccc(-c2ccnc3[nH]c(C)cc23)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H21N3O2S.C2HF3O2/c1-3-4-10-20-24(22,23)15-7-5-14(6-8-15)16-9-11-19-18-17(16)12-13(2)21-18;3-2(4,5)1(6)7/h5-9,11-12,20H,3-4,10H2,1-2H3,(H,19,21);(H,6,7) |
| InChIKey | OZYZIOFWOBDQJS-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.47 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|