C16H18N4O2S — CID 44591531
N-[2-(methylamino)ethyl]-4-(1H-pyrrolo[2,3-b]pyridin-4-yl)benzenesulfonamide (PubChem CID 44591531) has the molecular formula C16H18N4O2S and a molecular weight of 330.41 g/mol. Its IUPAC name is N-[2-(methylamino)ethyl]-4-(1H-pyrrolo[2,3-b]pyridin-4-yl)benzenesulfonamide.
| Compound Name | N-[2-(methylamino)ethyl]-4-(1H-pyrrolo[2,3-b]pyridin-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 44591531 |
| Molecular Formula | C16H18N4O2S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | N-[2-(methylamino)ethyl]-4-(1H-pyrrolo[2,3-b]pyridin-4-yl)benzenesulfonamide |
| SMILES | CNCCNS(=O)(=O)c1ccc(-c2ccnc3[nH]ccc23)cc1 |
| InChI | InChI=1S/C16H18N4O2S/c1-17-10-11-20-23(21,22)13-4-2-12(3-5-13)14-6-8-18-16-15(14)7-9-19-16/h2-9,17,20H,10-11H2,1H3,(H,18,19) |
| InChIKey | LDGNCLMLMHSOCB-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|