C14H22N2O3S — CID 2224602
3-[4-(ethylsulfamoyl)phenyl]-N-propylpropanamide (PubChem CID 2224602) has the molecular formula C14H22N2O3S and a molecular weight of 298.41 g/mol. Its IUPAC name is 3-[4-(ethylsulfamoyl)phenyl]-N-propylpropanamide.
| Compound Name | 3-[4-(ethylsulfamoyl)phenyl]-N-propylpropanamide |
|---|---|
| PubChem CID | 2224602 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 3-[4-(ethylsulfamoyl)phenyl]-N-propylpropanamide |
| SMILES | CCCNC(=O)CCc1ccc(S(=O)(=O)NCC)cc1 |
| InChI | InChI=1S/C14H22N2O3S/c1-3-11-15-14(17)10-7-12-5-8-13(9-6-12)20(18,19)16-4-2/h5-6,8-9,16H,3-4,7,10-11H2,1-2H3,(H,15,17) |
| InChIKey | CSWMOIRIISGIID-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |