C23H26N6O2S — CID 162360785
5-[2-ethoxy-5-[(2-methyl-4-pyridinyl)amino]sulfanylphenyl]-1-methyl-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-7-one (PubChem CID 162360785) has the molecular formula C23H26N6O2S and a molecular weight of 450.57 g/mol. Its IUPAC name is 5-[2-ethoxy-5-[(2-methyl-4-pyridinyl)amino]sulfanylphenyl]-1-methyl-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-7-one.
| Compound Name | 5-[2-ethoxy-5-[(2-methyl-4-pyridinyl)amino]sulfanylphenyl]-1-methyl-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 162360785 |
| Molecular Formula | C23H26N6O2S |
| Molecular Weight | 450.57 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 5-[2-ethoxy-5-[(2-methyl-4-pyridinyl)amino]sulfanylphenyl]-1-methyl-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-7-one |
| SMILES | CCCc1nn(C)c2c(=O)[nH]c(-c3cc(SNc4ccnc(C)c4)ccc3OCC)nc12 |
| InChI | InChI=1S/C23H26N6O2S/c1-5-7-18-20-21(29(4)27-18)23(30)26-22(25-20)17-13-16(8-9-19(17)31-6-2)32-28-15-10-11-24-14(3)12-15/h8-13H,5-7H2,1-4H3,(H,24,28)(H,25,26,30) |
| InChIKey | NCBSMYQNVWGLOO-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.57 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|