C20H27N7O2 — CID 135885069
1-[4-ethoxy-3-(1-methyl-7-oxo-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-5-yl)phenyl]-2-ethylguanidine (PubChem CID 135885069) has the molecular formula C20H27N7O2 and a molecular weight of 397.48 g/mol. Its IUPAC name is 1-[4-ethoxy-3-(1-methyl-7-oxo-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-5-yl)phenyl]-2-ethylguanidine.
| Compound Name | 1-[4-ethoxy-3-(1-methyl-7-oxo-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-5-yl)phenyl]-2-ethylguanidine |
|---|---|
| PubChem CID | 135885069 |
| Molecular Formula | C20H27N7O2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | 1-[4-ethoxy-3-(1-methyl-7-oxo-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-5-yl)phenyl]-2-ethylguanidine |
| SMILES | CCCc1nn(C)c2c(=O)[nH]c(-c3cc(N/C(N)=N/CC)ccc3OCC)nc12 |
| InChI | InChI=1S/C20H27N7O2/c1-5-8-14-16-17(27(4)26-14)19(28)25-18(24-16)13-11-12(23-20(21)22-6-2)9-10-15(13)29-7-3/h9-11H,5-8H2,1-4H3,(H3,21,22,23)(H,24,25,28) |
| InChIKey | ZDZKPOXNGHXAIM-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 123.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|