C17H20N6O2S — CID 143842587
1-[3-(1,3-dimethyl-7-oxo-6H-pyrazolo[4,5-d]pyrimidin-5-yl)-4-ethoxyphenyl]-3-methylthiourea (PubChem CID 143842587) has the molecular formula C17H20N6O2S and a molecular weight of 372.45 g/mol. Its IUPAC name is 1-[3-(1,3-dimethyl-7-oxo-6H-pyrazolo[4,5-d]pyrimidin-5-yl)-4-ethoxyphenyl]-3-methylthiourea.
| Compound Name | 1-[3-(1,3-dimethyl-7-oxo-6H-pyrazolo[4,5-d]pyrimidin-5-yl)-4-ethoxyphenyl]-3-methylthiourea |
|---|---|
| PubChem CID | 143842587 |
| Molecular Formula | C17H20N6O2S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 1-[3-(1,3-dimethyl-7-oxo-6H-pyrazolo[4,5-d]pyrimidin-5-yl)-4-ethoxyphenyl]-3-methylthiourea |
| SMILES | CCOc1ccc(NC(=S)NC)cc1-c1nc2c(C)nn(C)c2c(=O)[nH]1 |
| InChI | InChI=1S/C17H20N6O2S/c1-5-25-12-7-6-10(19-17(26)18-3)8-11(12)15-20-13-9(2)22-23(4)14(13)16(24)21-15/h6-8H,5H2,1-4H3,(H2,18,19,26)(H,20,21,24) |
| InChIKey | RLKKUMFUBVQXHD-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|