C18H23N7O2 — CID 143842589
1-[3-(1,3-dimethyl-7-oxo-6H-pyrazolo[4,5-d]pyrimidin-5-yl)-4-propoxyphenyl]-2-methylguanidine (PubChem CID 143842589) has the molecular formula C18H23N7O2 and a molecular weight of 369.43 g/mol. Its IUPAC name is 1-[3-(1,3-dimethyl-7-oxo-6H-pyrazolo[4,5-d]pyrimidin-5-yl)-4-propoxyphenyl]-2-methylguanidine.
| Compound Name | 1-[3-(1,3-dimethyl-7-oxo-6H-pyrazolo[4,5-d]pyrimidin-5-yl)-4-propoxyphenyl]-2-methylguanidine |
|---|---|
| PubChem CID | 143842589 |
| Molecular Formula | C18H23N7O2 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 1-[3-(1,3-dimethyl-7-oxo-6H-pyrazolo[4,5-d]pyrimidin-5-yl)-4-propoxyphenyl]-2-methylguanidine |
| SMILES | CCCOc1ccc(N/C(N)=N/C)cc1-c1nc2c(C)nn(C)c2c(=O)[nH]1 |
| InChI | InChI=1S/C18H23N7O2/c1-5-8-27-13-7-6-11(21-18(19)20-3)9-12(13)16-22-14-10(2)24-25(4)15(14)17(26)23-16/h6-7,9H,5,8H2,1-4H3,(H3,19,20,21)(H,22,23,26) |
| InChIKey | SCJXCXXGKSABQS-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 123.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|