C23H33N7O3 — CID 135884976
1-ethyl-1-(2-hydroxyethyl)-2-[3-(1-methyl-7-oxo-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-5-yl)-4-propoxyphenyl]guanidine (PubChem CID 135884976) has the molecular formula C23H33N7O3 and a molecular weight of 455.56 g/mol. Its IUPAC name is 1-ethyl-1-(2-hydroxyethyl)-2-[3-(1-methyl-7-oxo-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-5-yl)-4-propoxyphenyl]guanidine.
| Compound Name | 1-ethyl-1-(2-hydroxyethyl)-2-[3-(1-methyl-7-oxo-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-5-yl)-4-propoxyphenyl]guanidine |
|---|---|
| PubChem CID | 135884976 |
| Molecular Formula | C23H33N7O3 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.26 |
| IUPAC Name | 1-ethyl-1-(2-hydroxyethyl)-2-[3-(1-methyl-7-oxo-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-5-yl)-4-propoxyphenyl]guanidine |
| SMILES | CCCOc1ccc(/N=C(\N)N(CC)CCO)cc1-c1nc2c(CCC)nn(C)c2c(=O)[nH]1 |
| InChI | InChI=1S/C23H33N7O3/c1-5-8-17-19-20(29(4)28-17)22(32)27-21(26-19)16-14-15(9-10-18(16)33-13-6-2)25-23(24)30(7-3)11-12-31/h9-10,14,31H,5-8,11-13H2,1-4H3,(H2,24,25)(H,26,27,32) |
| InChIKey | IHWKIUOLTHFUAL-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 134.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|