C24H37N7O3 — CID 143842547
cyclopropane;2-[3-(1,3-dimethyl-7-oxo-6H-pyrazolo[4,5-d]pyrimidin-5-yl)-4-methylphenyl]-1,1-bis(2-hydroxyethyl)guanidine;ethane (PubChem CID 143842547) has the molecular formula C24H37N7O3 and a molecular weight of 471.61 g/mol. Its IUPAC name is cyclopropane;2-[3-(1,3-dimethyl-7-oxo-6H-pyrazolo[4,5-d]pyrimidin-5-yl)-4-methylphenyl]-1,1-bis(2-hydroxyethyl)guanidine;ethane.
| Compound Name | cyclopropane;2-[3-(1,3-dimethyl-7-oxo-6H-pyrazolo[4,5-d]pyrimidin-5-yl)-4-methylphenyl]-1,1-bis(2-hydroxyethyl)guanidine;ethane |
|---|---|
| PubChem CID | 143842547 |
| Molecular Formula | C24H37N7O3 |
| Molecular Weight | 471.61 g/mol |
| Exact Mass | 471.30 |
| IUPAC Name | cyclopropane;2-[3-(1,3-dimethyl-7-oxo-6H-pyrazolo[4,5-d]pyrimidin-5-yl)-4-methylphenyl]-1,1-bis(2-hydroxyethyl)guanidine;ethane |
| SMILES | C1CC1.CC.Cc1ccc(/N=C(\N)N(CCO)CCO)cc1-c1nc2c(C)nn(C)c2c(=O)[nH]1 |
| InChI | InChI=1S/C19H25N7O3.C3H6.C2H6/c1-11-4-5-13(21-19(20)26(6-8-27)7-9-28)10-14(11)17-22-15-12(2)24-25(3)16(15)18(29)23-17;1-2-3-1;1-2/h4-5,10,27-28H,6-9H2,1-3H3,(H2,20,21)(H,22,23,29);1-3H2;1-2H3 |
| InChIKey | VFTXCEGTZWHGGL-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 145.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.61 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|