C16H18ClN5O3S — CID 162361021
1-(5-chloro-1-methylpyrazol-4-yl)sulfonyl-4-[3-(furan-2-yl)-1H-pyrazol-5-yl]piperidine (PubChem CID 162361021) has the molecular formula C16H18ClN5O3S and a molecular weight of 395.87 g/mol. Its IUPAC name is 1-(5-chloro-1-methylpyrazol-4-yl)sulfonyl-4-[3-(furan-2-yl)-1H-pyrazol-5-yl]piperidine.
| Compound Name | 1-(5-chloro-1-methylpyrazol-4-yl)sulfonyl-4-[3-(furan-2-yl)-1H-pyrazol-5-yl]piperidine |
|---|---|
| PubChem CID | 162361021 |
| Molecular Formula | C16H18ClN5O3S |
| Molecular Weight | 395.87 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | 1-(5-chloro-1-methylpyrazol-4-yl)sulfonyl-4-[3-(furan-2-yl)-1H-pyrazol-5-yl]piperidine |
| SMILES | Cn1ncc(S(=O)(=O)N2CCC(c3cc(-c4ccco4)n[nH]3)CC2)c1Cl |
| InChI | InChI=1S/C16H18ClN5O3S/c1-21-16(17)15(10-18-21)26(23,24)22-6-4-11(5-7-22)12-9-13(20-19-12)14-3-2-8-25-14/h2-3,8-11H,4-7H2,1H3,(H,19,20) |
| InChIKey | CUDRSCVDIYYPPI-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.87 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |