C22H22N4O3S — CID 71839608
4-[4-[3-(3-methoxyphenyl)-1H-pyrazol-5-yl]piperidin-1-yl]sulfonylbenzonitrile (PubChem CID 71839608) has the molecular formula C22H22N4O3S and a molecular weight of 422.51 g/mol. Its IUPAC name is 4-[4-[3-(3-methoxyphenyl)-1H-pyrazol-5-yl]piperidin-1-yl]sulfonylbenzonitrile.
| Compound Name | 4-[4-[3-(3-methoxyphenyl)-1H-pyrazol-5-yl]piperidin-1-yl]sulfonylbenzonitrile |
|---|---|
| PubChem CID | 71839608 |
| Molecular Formula | C22H22N4O3S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 4-[4-[3-(3-methoxyphenyl)-1H-pyrazol-5-yl]piperidin-1-yl]sulfonylbenzonitrile |
| SMILES | COc1cccc(-c2cc(C3CCN(S(=O)(=O)c4ccc(C#N)cc4)CC3)[nH]n2)c1 |
| InChI | InChI=1S/C22H22N4O3S/c1-29-19-4-2-3-18(13-19)22-14-21(24-25-22)17-9-11-26(12-10-17)30(27,28)20-7-5-16(15-23)6-8-20/h2-8,13-14,17H,9-12H2,1H3,(H,24,25) |
| InChIKey | UODQAPFJAUQUNX-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |