C25H25N3O4S — CID 41287615
1-(4-cyanophenyl)sulfonyl-N-[(6-methoxynaphthalen-2-yl)methyl]piperidine-4-carboxamide (PubChem CID 41287615) has the molecular formula C25H25N3O4S and a molecular weight of 463.56 g/mol. Its IUPAC name is 1-(4-cyanophenyl)sulfonyl-N-[(6-methoxynaphthalen-2-yl)methyl]piperidine-4-carboxamide.
| Compound Name | 1-(4-cyanophenyl)sulfonyl-N-[(6-methoxynaphthalen-2-yl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 41287615 |
| Molecular Formula | C25H25N3O4S |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | 1-(4-cyanophenyl)sulfonyl-N-[(6-methoxynaphthalen-2-yl)methyl]piperidine-4-carboxamide |
| SMILES | COc1ccc2cc(CNC(=O)C3CCN(S(=O)(=O)c4ccc(C#N)cc4)CC3)ccc2c1 |
| InChI | InChI=1S/C25H25N3O4S/c1-32-23-7-6-21-14-19(2-5-22(21)15-23)17-27-25(29)20-10-12-28(13-11-20)33(30,31)24-8-3-18(16-26)4-9-24/h2-9,14-15,20H,10-13,17H2,1H3,(H,27,29) |
| InChIKey | AIJUWEFWORBFDT-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |