C25H31N5O3S — CID 55847105
N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-1-(4-cyanophenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 55847105) has the molecular formula C25H31N5O3S and a molecular weight of 481.62 g/mol. Its IUPAC name is N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-1-(4-cyanophenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-1-(4-cyanophenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 55847105 |
| Molecular Formula | C25H31N5O3S |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-1-(4-cyanophenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | N#Cc1ccc(S(=O)(=O)N2CCC(C(=O)NCc3ccc(N4CCCCCC4)nc3)CC2)cc1 |
| InChI | InChI=1S/C25H31N5O3S/c26-17-20-5-8-23(9-6-20)34(32,33)30-15-11-22(12-16-30)25(31)28-19-21-7-10-24(27-18-21)29-13-3-1-2-4-14-29/h5-10,18,22H,1-4,11-16,19H2,(H,28,31) |
| InChIKey | WXVMDNMWAPPSOK-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 106.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |