C18H35N3O — CID 162362108
ethane;(2E,4E)-N-methyl-5-[3-(4-methylpiperazin-1-yl)propoxy]hepta-2,4,6-trien-3-amine (PubChem CID 162362108) has the molecular formula C18H35N3O and a molecular weight of 309.50 g/mol. Its IUPAC name is ethane;(2E,4E)-N-methyl-5-[3-(4-methylpiperazin-1-yl)propoxy]hepta-2,4,6-trien-3-amine.
| Compound Name | ethane;(2E,4E)-N-methyl-5-[3-(4-methylpiperazin-1-yl)propoxy]hepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 162362108 |
| Molecular Formula | C18H35N3O |
| Molecular Weight | 309.50 g/mol |
| Exact Mass | 309.28 |
| IUPAC Name | ethane;(2E,4E)-N-methyl-5-[3-(4-methylpiperazin-1-yl)propoxy]hepta-2,4,6-trien-3-amine |
| SMILES | C=C/C(=C\C(=C/C)NC)OCCCN1CCN(C)CC1.CC |
| InChI | InChI=1S/C16H29N3O.C2H6/c1-5-15(17-3)14-16(6-2)20-13-7-8-19-11-9-18(4)10-12-19;1-2/h5-6,14,17H,2,7-13H2,1,3-4H3;1-2H3/b15-5+,16-14+; |
| InChIKey | ZGQMQHJCVDRDHK-LINDZGSJSA-N |
| XLogP | 2.86 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.50 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|