C19H30N2O — CID 2994741
1-[3-(2,6-dimethyl-4-prop-2-enylphenoxy)propyl]-4-methylpiperazine (PubChem CID 2994741) has the molecular formula C19H30N2O and a molecular weight of 302.46 g/mol. Its IUPAC name is 1-[3-(2,6-dimethyl-4-prop-2-enylphenoxy)propyl]-4-methylpiperazine.
| Compound Name | 1-[3-(2,6-dimethyl-4-prop-2-enylphenoxy)propyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 2994741 |
| Molecular Formula | C19H30N2O |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.24 |
| IUPAC Name | 1-[3-(2,6-dimethyl-4-prop-2-enylphenoxy)propyl]-4-methylpiperazine |
| SMILES | C=CCc1cc(C)c(OCCCN2CCN(C)CC2)c(C)c1 |
| InChI | InChI=1S/C19H30N2O/c1-5-7-18-14-16(2)19(17(3)15-18)22-13-6-8-21-11-9-20(4)10-12-21/h5,14-15H,1,6-13H2,2-4H3 |
| InChIKey | NXULWLODKXVHOU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|