C56H57N3 — CID 162363064
2-cyclohepta-1,6-dien-1-yl-4-(4-methylphenyl)-6-(4-phenylphenyl)-1,3,5-triazine;ethane;2,9,9-trimethyl-3-(2-propylphenyl)fluorene (PubChem CID 162363064) has the molecular formula C56H57N3 and a molecular weight of 772.09 g/mol. Its IUPAC name is 2-cyclohepta-1,6-dien-1-yl-4-(4-methylphenyl)-6-(4-phenylphenyl)-1,3,5-triazine;ethane;2,9,9-trimethyl-3-(2-propylphenyl)fluorene.
| Compound Name | 2-cyclohepta-1,6-dien-1-yl-4-(4-methylphenyl)-6-(4-phenylphenyl)-1,3,5-triazine;ethane;2,9,9-trimethyl-3-(2-propylphenyl)fluorene |
|---|---|
| PubChem CID | 162363064 |
| Molecular Formula | C56H57N3 |
| Molecular Weight | 772.09 g/mol |
| Exact Mass | 771.46 |
| IUPAC Name | 2-cyclohepta-1,6-dien-1-yl-4-(4-methylphenyl)-6-(4-phenylphenyl)-1,3,5-triazine;ethane;2,9,9-trimethyl-3-(2-propylphenyl)fluorene |
| SMILES | CC.CCCc1ccccc1-c1cc2c(cc1C)C(C)(C)c1ccccc1-2.Cc1ccc(-c2nc(C3=CCCCC=C3)nc(-c3ccc(-c4ccccc4)cc3)n2)cc1 |
| InChI | InChI=1S/C29H25N3.C25H26.C2H6/c1-21-13-15-25(16-14-21)28-30-27(24-11-5-2-3-6-12-24)31-29(32-28)26-19-17-23(18-20-26)22-9-7-4-8-10-22;1-5-10-18-11-6-7-12-19(18)21-16-22-20-13-8-9-14-23(20)25(3,4)24(22)15-17(21)2;1-2/h4-5,7-20H,2-3,6H2,1H3;6-9,11-16H,5,10H2,1-4H3;1-2H3 |
| InChIKey | KRRWYFITMSMZDS-UHFFFAOYSA-N |
| XLogP | 15.25 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.09 |
| LogP ≤ 5 | 15.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |