C52H41N5O — CID 162363460
benzenecarboximidamide;5-methyl-11-phenylindolo[3,2-b]carbazole;N-[(1-phenyldibenzofuran-3-yl)methyl]methanimine (PubChem CID 162363460) has the molecular formula C52H41N5O and a molecular weight of 751.93 g/mol. Its IUPAC name is benzenecarboximidamide;5-methyl-11-phenylindolo[3,2-b]carbazole;N-[(1-phenyldibenzofuran-3-yl)methyl]methanimine.
| Compound Name | benzenecarboximidamide;5-methyl-11-phenylindolo[3,2-b]carbazole;N-[(1-phenyldibenzofuran-3-yl)methyl]methanimine |
|---|---|
| PubChem CID | 162363460 |
| Molecular Formula | C52H41N5O |
| Molecular Weight | 751.93 g/mol |
| Exact Mass | 751.33 |
| IUPAC Name | benzenecarboximidamide;5-methyl-11-phenylindolo[3,2-b]carbazole;N-[(1-phenyldibenzofuran-3-yl)methyl]methanimine |
| SMILES | C=NCc1cc(-c2ccccc2)c2c(c1)oc1ccccc12.Cn1c2ccccc2c2cc3c(cc21)c1ccccc1n3-c1ccccc1.[H]/N=C(\N)c1ccccc1 |
| InChI | InChI=1S/C25H18N2.C20H15NO.C7H8N2/c1-26-22-13-7-5-11-18(22)20-16-25-21(15-24(20)26)19-12-6-8-14-23(19)27(25)17-9-3-2-4-10-17;1-21-13-14-11-17(15-7-3-2-4-8-15)20-16-9-5-6-10-18(16)22-19(20)12-14;8-7(9)6-4-2-1-3-5-6/h2-16H,1H3;2-12H,1,13H2;1-5H,(H3,8,9) |
| InChIKey | LBRIFOQCQFOUGM-UHFFFAOYSA-N |
| XLogP | 12.85 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.93 |
| LogP ≤ 5 | 12.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|