C8H12N4 — CID 162364116
6-imino-1-methanimidoyl-N,5-dimethylpyridin-3-amine (PubChem CID 162364116) has the molecular formula C8H12N4 and a molecular weight of 164.21 g/mol. Its IUPAC name is 6-imino-1-methanimidoyl-N,5-dimethylpyridin-3-amine.
| Compound Name | 6-imino-1-methanimidoyl-N,5-dimethylpyridin-3-amine |
|---|---|
| PubChem CID | 162364116 |
| Molecular Formula | C8H12N4 |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | 6-imino-1-methanimidoyl-N,5-dimethylpyridin-3-amine |
| SMILES | [H]/N=C/n1cc(NC)cc(C)/c1=N\[H] |
| InChI | InChI=1S/C8H12N4/c1-6-3-7(11-2)4-12(5-9)8(6)10/h3-5,9-11H,1-2H3/b9-5+,10-8+ |
| InChIKey | XWTOXTSCLOHYDC-MUDDOMJDSA-N |
| XLogP | 0.77 |
| TPSA | 64.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|