C8H10F2N4 — CID 144749911
1-(2,2-difluoroethanimidoyl)-6-imino-5-methylpyridin-3-amine (PubChem CID 144749911) has the molecular formula C8H10F2N4 and a molecular weight of 200.19 g/mol. Its IUPAC name is 1-(2,2-difluoroethanimidoyl)-6-imino-5-methylpyridin-3-amine.
| Compound Name | 1-(2,2-difluoroethanimidoyl)-6-imino-5-methylpyridin-3-amine |
|---|---|
| PubChem CID | 144749911 |
| Molecular Formula | C8H10F2N4 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 1-(2,2-difluoroethanimidoyl)-6-imino-5-methylpyridin-3-amine |
| SMILES | [H]/N=C(\C(F)F)n1cc(N)cc(C)/c1=N\[H] |
| InChI | InChI=1S/C8H10F2N4/c1-4-2-5(11)3-14(7(4)12)8(13)6(9)10/h2-3,6,12-13H,11H2,1H3/b12-7+,13-8+ |
| InChIKey | YOGDABOSOIXCLQ-INOXDZRUSA-N |
| XLogP | 0.95 |
| TPSA | 78.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|